C27H19N3O5S — CID 4696945
4-hydroxy-1-(6-methyl-1,3-benzothiazol-2-yl)-2-(3-nitrophenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4696945) has the molecular formula C27H19N3O5S and a molecular weight of 497.53 g/mol. Its IUPAC name is 4-hydroxy-1-(6-methyl-1,3-benzothiazol-2-yl)-2-(3-nitrophenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-(6-methyl-1,3-benzothiazol-2-yl)-2-(3-nitrophenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4696945 |
| Molecular Formula | C27H19N3O5S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 4-hydroxy-1-(6-methyl-1,3-benzothiazol-2-yl)-2-(3-nitrophenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | Cc1ccc2nc(N3C(=O)C(O)=C(C(=O)C=Cc4ccccc4)C3c3cccc([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C27H19N3O5S/c1-16-10-12-20-22(14-16)36-27(28-20)29-24(18-8-5-9-19(15-18)30(34)35)23(25(32)26(29)33)21(31)13-11-17-6-3-2-4-7-17/h2-15,24,32H,1H3 |
| InChIKey | NIOROWGUDGASFP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|