C26H21N3O7S — CID 6188882
ethyl 2-[4-hydroxy-2-(3-nitrophenyl)-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 6188882) has the molecular formula C26H21N3O7S and a molecular weight of 519.54 g/mol. Its IUPAC name is ethyl 2-[4-hydroxy-2-(3-nitrophenyl)-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[4-hydroxy-2-(3-nitrophenyl)-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 6188882 |
| Molecular Formula | C26H21N3O7S |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | ethyl 2-[4-hydroxy-2-(3-nitrophenyl)-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2C(=O)C(O)=C(C(=O)/C=C/c3ccccc3)C2c2cccc([N+](=O)[O-])c2)nc1C |
| InChI | InChI=1S/C26H21N3O7S/c1-3-36-25(33)23-15(2)27-26(37-23)28-21(17-10-7-11-18(14-17)29(34)35)20(22(31)24(28)32)19(30)13-12-16-8-5-4-6-9-16/h4-14,21,31H,3H2,1-2H3/b13-12+ |
| InChIKey | FLBCOTGGASKTHR-OUKQBFOZSA-N |
| XLogP | 4.72 |
| TPSA | 139.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|