C28H24N2O5S — CID 4696186
prop-2-enyl 2-[4-hydroxy-2-(4-methylphenyl)-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4696186) has the molecular formula C28H24N2O5S and a molecular weight of 500.58 g/mol. Its IUPAC name is prop-2-enyl 2-[4-hydroxy-2-(4-methylphenyl)-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[4-hydroxy-2-(4-methylphenyl)-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4696186 |
| Molecular Formula | C28H24N2O5S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | prop-2-enyl 2-[4-hydroxy-2-(4-methylphenyl)-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(O)=C(C(=O)C=Cc3ccccc3)C2c2ccc(C)cc2)nc1C |
| InChI | InChI=1S/C28H24N2O5S/c1-4-16-35-27(34)25-18(3)29-28(36-25)30-23(20-13-10-17(2)11-14-20)22(24(32)26(30)33)21(31)15-12-19-8-6-5-7-9-19/h4-15,23,32H,1,16H2,2-3H3 |
| InChIKey | VGKFQOVRDOVGHJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|