C30H28N2O6S — CID 6188950
prop-2-enyl 2-[4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2-(4-propoxyphenyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 6188950) has the molecular formula C30H28N2O6S and a molecular weight of 544.63 g/mol. Its IUPAC name is prop-2-enyl 2-[4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2-(4-propoxyphenyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2-(4-propoxyphenyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 6188950 |
| Molecular Formula | C30H28N2O6S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | prop-2-enyl 2-[4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2-(4-propoxyphenyl)-2H-pyrrol-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(O)=C(C(=O)/C=C/c3ccccc3)C2c2ccc(OCCC)cc2)nc1C |
| InChI | InChI=1S/C30H28N2O6S/c1-4-17-37-22-14-12-21(13-15-22)25-24(23(33)16-11-20-9-7-6-8-10-20)26(34)28(35)32(25)30-31-19(3)27(39-30)29(36)38-18-5-2/h5-16,25,34H,2,4,17-18H2,1,3H3/b16-11+ |
| InChIKey | MJSYOJXYIOULII-LFIBNONCSA-N |
| XLogP | 5.77 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|