C27H19FN2O3S — CID 4696973
2-(2-fluorophenyl)-4-hydroxy-1-(6-methyl-1,3-benzothiazol-2-yl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4696973) has the molecular formula C27H19FN2O3S and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-4-hydroxy-1-(6-methyl-1,3-benzothiazol-2-yl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 2-(2-fluorophenyl)-4-hydroxy-1-(6-methyl-1,3-benzothiazol-2-yl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4696973 |
| Molecular Formula | C27H19FN2O3S |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 2-(2-fluorophenyl)-4-hydroxy-1-(6-methyl-1,3-benzothiazol-2-yl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | Cc1ccc2nc(N3C(=O)C(O)=C(C(=O)C=Cc4ccccc4)C3c3ccccc3F)sc2c1 |
| InChI | InChI=1S/C27H19FN2O3S/c1-16-11-13-20-22(15-16)34-27(29-20)30-24(18-9-5-6-10-19(18)28)23(25(32)26(30)33)21(31)14-12-17-7-3-2-4-8-17/h2-15,24,32H,1H3 |
| InChIKey | MBGGROZCLPYETO-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|