C19H13N3O5S — CID 7478389
(2S)-3-acetyl-1-(1,3-benzothiazol-2-yl)-4-hydroxy-2-(3-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 7478389) has the molecular formula C19H13N3O5S and a molecular weight of 395.40 g/mol. Its IUPAC name is (2S)-3-acetyl-1-(1,3-benzothiazol-2-yl)-4-hydroxy-2-(3-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | (2S)-3-acetyl-1-(1,3-benzothiazol-2-yl)-4-hydroxy-2-(3-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 7478389 |
| Molecular Formula | C19H13N3O5S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | (2S)-3-acetyl-1-(1,3-benzothiazol-2-yl)-4-hydroxy-2-(3-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | CC(=O)C1=C(O)C(=O)N(c2nc3ccccc3s2)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H13N3O5S/c1-10(23)15-16(11-5-4-6-12(9-11)22(26)27)21(18(25)17(15)24)19-20-13-7-2-3-8-14(13)28-19/h2-9,16,24H,1H3/t16-/m0/s1 |
| InChIKey | JTCKYSYEJBNINA-INIZCTEOSA-N |
| XLogP | 3.69 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|