C23H14ClN3O5S2 — CID 58286251
1-(4-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-3-(5-methylthiophene-2-carbonyl)-2-(3-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 58286251) has the molecular formula C23H14ClN3O5S2 and a molecular weight of 511.97 g/mol. Its IUPAC name is 1-(4-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-3-(5-methylthiophene-2-carbonyl)-2-(3-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | 1-(4-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-3-(5-methylthiophene-2-carbonyl)-2-(3-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 58286251 |
| Molecular Formula | C23H14ClN3O5S2 |
| Molecular Weight | 511.97 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | 1-(4-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-3-(5-methylthiophene-2-carbonyl)-2-(3-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | Cc1ccc(C(=O)C2=C(O)C(=O)N(c3nc4c(Cl)cccc4s3)C2c2cccc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C23H14ClN3O5S2/c1-11-8-9-16(33-11)20(28)17-19(12-4-2-5-13(10-12)27(31)32)26(22(30)21(17)29)23-25-18-14(24)6-3-7-15(18)34-23/h2-10,19,29H,1H3 |
| InChIKey | KKSBUVAJHZCYOA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.97 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|