C25H19N5O5S3 — CID 4733850
1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-2-(3-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 4733850) has the molecular formula C25H19N5O5S3 and a molecular weight of 565.66 g/mol. Its IUPAC name is 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-2-(3-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-2-(3-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4733850 |
| Molecular Formula | C25H19N5O5S3 |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.05 |
| IUPAC Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-2-(3-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | Cc1nc(C)c(C(=O)C2=C(O)C(=O)N(c3nnc(SCc4ccccc4)s3)C2c2cccc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C25H19N5O5S3/c1-13-22(37-14(2)26-13)20(31)18-19(16-9-6-10-17(11-16)30(34)35)29(23(33)21(18)32)24-27-28-25(38-24)36-12-15-7-4-3-5-8-15/h3-11,19,32H,12H2,1-2H3 |
| InChIKey | IHXGKOMBRYFSRO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 139.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|