C26H20N4O6S2 — CID 18814013
4-hydroxy-3-(5-methylfuran-2-carbonyl)-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(3-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 18814013) has the molecular formula C26H20N4O6S2 and a molecular weight of 548.60 g/mol. Its IUPAC name is 4-hydroxy-3-(5-methylfuran-2-carbonyl)-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(3-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-3-(5-methylfuran-2-carbonyl)-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(3-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 18814013 |
| Molecular Formula | C26H20N4O6S2 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | 4-hydroxy-3-(5-methylfuran-2-carbonyl)-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(3-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | Cc1ccc(CSc2nnc(N3C(=O)C(O)=C(C(=O)c4ccc(C)o4)C3c3cccc([N+](=O)[O-])c3)s2)cc1 |
| InChI | InChI=1S/C26H20N4O6S2/c1-14-6-9-16(10-7-14)13-37-26-28-27-25(38-26)29-21(17-4-3-5-18(12-17)30(34)35)20(23(32)24(29)33)22(31)19-11-8-15(2)36-19/h3-12,21,32H,13H2,1-2H3 |
| InChIKey | MGGNKARBNCHUOF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|