C26H19N3O6S — CID 58285967
4-hydroxy-3-(5-methylfuran-2-carbonyl)-1-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-(3-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 58285967) has the molecular formula C26H19N3O6S and a molecular weight of 501.52 g/mol. Its IUPAC name is 4-hydroxy-3-(5-methylfuran-2-carbonyl)-1-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-(3-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-3-(5-methylfuran-2-carbonyl)-1-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-(3-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 58285967 |
| Molecular Formula | C26H19N3O6S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 4-hydroxy-3-(5-methylfuran-2-carbonyl)-1-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-(3-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | Cc1ccc(-c2csc(N3C(=O)C(O)=C(C(=O)c4ccc(C)o4)C3c3cccc([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C26H19N3O6S/c1-14-6-9-16(10-7-14)19-13-36-26(27-19)28-22(17-4-3-5-18(12-17)29(33)34)21(24(31)25(28)32)23(30)20-11-8-15(2)35-20/h3-13,22,31H,1-2H3 |
| InChIKey | UZYOTORIMVURHR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 126.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|