C16H10N4O7S — CID 146023292
4-hydroxy-3-(5-methylfuran-2-carbonyl)-2-(5-nitrofuran-2-yl)-1-(1,3,4-thiadiazol-2-yl)-2H-pyrrol-5-one (PubChem CID 146023292) has the molecular formula C16H10N4O7S and a molecular weight of 402.34 g/mol. Its IUPAC name is 4-hydroxy-3-(5-methylfuran-2-carbonyl)-2-(5-nitrofuran-2-yl)-1-(1,3,4-thiadiazol-2-yl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-3-(5-methylfuran-2-carbonyl)-2-(5-nitrofuran-2-yl)-1-(1,3,4-thiadiazol-2-yl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 146023292 |
| Molecular Formula | C16H10N4O7S |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 4-hydroxy-3-(5-methylfuran-2-carbonyl)-2-(5-nitrofuran-2-yl)-1-(1,3,4-thiadiazol-2-yl)-2H-pyrrol-5-one |
| SMILES | Cc1ccc(C(=O)C2=C(O)C(=O)N(c3nncs3)C2c2ccc([N+](=O)[O-])o2)o1 |
| InChI | InChI=1S/C16H10N4O7S/c1-7-2-3-9(26-7)13(21)11-12(8-4-5-10(27-8)20(24)25)19(15(23)14(11)22)16-18-17-6-28-16/h2-6,12,22H,1H3 |
| InChIKey | IQCZQLOXHSVRHB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 152.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|