C23H15N3O6S — CID 58285998
4-hydroxy-3-(5-methylfuran-2-carbonyl)-1-(6-nitro-1,3-benzothiazol-2-yl)-2-phenyl-2H-pyrrol-5-one (PubChem CID 58285998) has the molecular formula C23H15N3O6S and a molecular weight of 461.46 g/mol. Its IUPAC name is 4-hydroxy-3-(5-methylfuran-2-carbonyl)-1-(6-nitro-1,3-benzothiazol-2-yl)-2-phenyl-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-3-(5-methylfuran-2-carbonyl)-1-(6-nitro-1,3-benzothiazol-2-yl)-2-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 58285998 |
| Molecular Formula | C23H15N3O6S |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 4-hydroxy-3-(5-methylfuran-2-carbonyl)-1-(6-nitro-1,3-benzothiazol-2-yl)-2-phenyl-2H-pyrrol-5-one |
| SMILES | Cc1ccc(C(=O)C2=C(O)C(=O)N(c3nc4ccc([N+](=O)[O-])cc4s3)C2c2ccccc2)o1 |
| InChI | InChI=1S/C23H15N3O6S/c1-12-7-10-16(32-12)20(27)18-19(13-5-3-2-4-6-13)25(22(29)21(18)28)23-24-15-9-8-14(26(30)31)11-17(15)33-23/h2-11,19,28H,1H3 |
| InChIKey | AXTGJRUUNJXRFI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 126.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|