C26H15ClN4O7S — CID 108724962
3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-(6-nitro-1,3-benzothiazol-2-yl)-2-pyridin-3-yl-2H-pyrrol-5-one (PubChem CID 108724962) has the molecular formula C26H15ClN4O7S and a molecular weight of 562.95 g/mol. Its IUPAC name is 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-(6-nitro-1,3-benzothiazol-2-yl)-2-pyridin-3-yl-2H-pyrrol-5-one.
| Compound Name | 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-(6-nitro-1,3-benzothiazol-2-yl)-2-pyridin-3-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108724962 |
| Molecular Formula | C26H15ClN4O7S |
| Molecular Weight | 562.95 g/mol |
| Exact Mass | 562.03 |
| IUPAC Name | 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-(6-nitro-1,3-benzothiazol-2-yl)-2-pyridin-3-yl-2H-pyrrol-5-one |
| SMILES | COc1cc(Cl)cc2cc(C(=O)C3=C(O)C(=O)N(c4nc5ccc([N+](=O)[O-])cc5s4)C3c3cccnc3)oc12 |
| InChI | InChI=1S/C26H15ClN4O7S/c1-37-18-9-14(27)7-13-8-17(38-24(13)18)22(32)20-21(12-3-2-6-28-11-12)30(25(34)23(20)33)26-29-16-5-4-15(31(35)36)10-19(16)39-26/h2-11,21,33H,1H3 |
| InChIKey | NGQLYVSSOIAYFM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.95 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|