C24H17N3O5S2 — CID 3734046
1-(6-ethyl-1,3-benzothiazol-2-yl)-4-hydroxy-2-(3-nitrophenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 3734046) has the molecular formula C24H17N3O5S2 and a molecular weight of 491.55 g/mol. Its IUPAC name is 1-(6-ethyl-1,3-benzothiazol-2-yl)-4-hydroxy-2-(3-nitrophenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 1-(6-ethyl-1,3-benzothiazol-2-yl)-4-hydroxy-2-(3-nitrophenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3734046 |
| Molecular Formula | C24H17N3O5S2 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 1-(6-ethyl-1,3-benzothiazol-2-yl)-4-hydroxy-2-(3-nitrophenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCc1ccc2nc(N3C(=O)C(O)=C(C(=O)c4cccs4)C3c3cccc([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C24H17N3O5S2/c1-2-13-8-9-16-18(11-13)34-24(25-16)26-20(14-5-3-6-15(12-14)27(31)32)19(22(29)23(26)30)21(28)17-7-4-10-33-17/h3-12,20,29H,2H2,1H3 |
| InChIKey | NQSGJSJIXDOHEY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|