C20H11N3O5S3 — CID 108722818
4-hydroxy-1-(6-nitro-1,3-benzothiazol-2-yl)-3-(thiophene-2-carbonyl)-2-thiophen-2-yl-2H-pyrrol-5-one (PubChem CID 108722818) has the molecular formula C20H11N3O5S3 and a molecular weight of 469.53 g/mol. Its IUPAC name is 4-hydroxy-1-(6-nitro-1,3-benzothiazol-2-yl)-3-(thiophene-2-carbonyl)-2-thiophen-2-yl-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-(6-nitro-1,3-benzothiazol-2-yl)-3-(thiophene-2-carbonyl)-2-thiophen-2-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108722818 |
| Molecular Formula | C20H11N3O5S3 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | 4-hydroxy-1-(6-nitro-1,3-benzothiazol-2-yl)-3-(thiophene-2-carbonyl)-2-thiophen-2-yl-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(c2nc3ccc([N+](=O)[O-])cc3s2)C1c1cccs1)c1cccs1 |
| InChI | InChI=1S/C20H11N3O5S3/c24-17(13-4-2-8-30-13)15-16(12-3-1-7-29-12)22(19(26)18(15)25)20-21-11-6-5-10(23(27)28)9-14(11)31-20/h1-9,16,25H |
| InChIKey | KCCHAEPXERPRGA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|