C22H12FN3O5S2 — CID 108722859
(4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108722859) has the molecular formula C22H12FN3O5S2 and a molecular weight of 481.49 g/mol. Its IUPAC name is (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108722859 |
| Molecular Formula | C22H12FN3O5S2 |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3ccc([N+](=O)[O-])cc3s2)C(c2cccs2)/C1=C(\O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H12FN3O5S2/c23-12-5-3-11(4-6-12)19(27)17-18(15-2-1-9-32-15)25(21(29)20(17)28)22-24-14-8-7-13(26(30)31)10-16(14)33-22/h1-10,18,27H/b19-17+ |
| InChIKey | NDMYEQOPPDPGHG-HTXNQAPBSA-N |
| XLogP | 5.03 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|