C26H15N3O5S2 — CID 108722856
(4E)-4-[hydroxy(naphthalen-1-yl)methylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108722856) has the molecular formula C26H15N3O5S2 and a molecular weight of 513.56 g/mol. Its IUPAC name is (4E)-4-[hydroxy(naphthalen-1-yl)methylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy(naphthalen-1-yl)methylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108722856 |
| Molecular Formula | C26H15N3O5S2 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | (4E)-4-[hydroxy(naphthalen-1-yl)methylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3ccc([N+](=O)[O-])cc3s2)C(c2cccs2)/C1=C(\O)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H15N3O5S2/c30-23(17-8-3-6-14-5-1-2-7-16(14)17)21-22(19-9-4-12-35-19)28(25(32)24(21)31)26-27-18-11-10-15(29(33)34)13-20(18)36-26/h1-13,22,30H/b23-21+ |
| InChIKey | GQFWJQWLELVTTQ-XTQSDGFTSA-N |
| XLogP | 6.05 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|