C27H17ClN2O3S2 — CID 108723030
(4E)-1-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-4-[hydroxy(naphthalen-1-yl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108723030) has the molecular formula C27H17ClN2O3S2 and a molecular weight of 517.03 g/mol. Its IUPAC name is (4E)-1-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-4-[hydroxy(naphthalen-1-yl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-4-[hydroxy(naphthalen-1-yl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108723030 |
| Molecular Formula | C27H17ClN2O3S2 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | (4E)-1-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-4-[hydroxy(naphthalen-1-yl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | Cc1cc2sc(N3C(=O)C(=O)/C(=C(/O)c4cccc5ccccc45)C3c3cccs3)nc2cc1Cl |
| InChI | InChI=1S/C27H17ClN2O3S2/c1-14-12-21-19(13-18(14)28)29-27(35-21)30-23(20-10-5-11-34-20)22(25(32)26(30)33)24(31)17-9-4-7-15-6-2-3-8-16(15)17/h2-13,23,31H,1H3/b24-22+ |
| InChIKey | OHZKYNKFGMGZNT-ZNTNEXAZSA-N |
| XLogP | 7.10 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|