C26H21ClN2O4S2 — CID 108723042
(4E)-1-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108723042) has the molecular formula C26H21ClN2O4S2 and a molecular weight of 525.05 g/mol. Its IUPAC name is (4E)-1-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108723042 |
| Molecular Formula | C26H21ClN2O4S2 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | (4E)-1-(5-chloro-6-methyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | Cc1cc2sc(N3C(=O)C(=O)/C(=C(/O)c4ccc(OC(C)C)cc4)C3c3cccs3)nc2cc1Cl |
| InChI | InChI=1S/C26H21ClN2O4S2/c1-13(2)33-16-8-6-15(7-9-16)23(30)21-22(19-5-4-10-34-19)29(25(32)24(21)31)26-28-18-12-17(27)14(3)11-20(18)35-26/h4-13,22,30H,1-3H3/b23-21+ |
| InChIKey | UNPLUJUXLBDESZ-XTQSDGFTSA-N |
| XLogP | 6.73 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|