C25H19N3O6S2 — CID 108722868
(4E)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108722868) has the molecular formula C25H19N3O6S2 and a molecular weight of 521.58 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108722868 |
| Molecular Formula | C25H19N3O6S2 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | (4E)-4-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | CC(C)Oc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc([N+](=O)[O-])cc4s3)C2c2cccs2)cc1 |
| InChI | InChI=1S/C25H19N3O6S2/c1-13(2)34-16-8-5-14(6-9-16)22(29)20-21(18-4-3-11-35-18)27(24(31)23(20)30)25-26-17-10-7-15(28(32)33)12-19(17)36-25/h3-13,21,29H,1-2H3/b22-20+ |
| InChIKey | FDTREZKFNRSNBI-LSDHQDQOSA-N |
| XLogP | 5.68 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|