C23H14BrClN2O3S2 — CID 108722666
(4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-(6-chloro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108722666) has the molecular formula C23H14BrClN2O3S2 and a molecular weight of 545.87 g/mol. Its IUPAC name is (4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-(6-chloro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-(6-chloro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108722666 |
| Molecular Formula | C23H14BrClN2O3S2 |
| Molecular Weight | 545.87 g/mol |
| Exact Mass | 543.93 |
| IUPAC Name | (4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-(6-chloro-1,3-benzothiazol-2-yl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | Cc1cc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(Cl)cc4s3)C2c2cccs2)ccc1Br |
| InChI | InChI=1S/C23H14BrClN2O3S2/c1-11-9-12(4-6-14(11)24)20(28)18-19(16-3-2-8-31-16)27(22(30)21(18)29)23-26-15-7-5-13(25)10-17(15)32-23/h2-10,19,28H,1H3/b20-18+ |
| InChIKey | MQOYSPFVXYJFNV-CZIZESTLSA-N |
| XLogP | 6.71 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.87 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|