C24H15ClN2O5S2 — CID 41084789
(5R)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 41084789) has the molecular formula C24H15ClN2O5S2 and a molecular weight of 510.98 g/mol. Its IUPAC name is (5R)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (5R)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41084789 |
| Molecular Formula | C24H15ClN2O5S2 |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.01 |
| IUPAC Name | (5R)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3ccc(Cl)cc3s2)[C@@H](c2cccs2)C1=C(O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H15ClN2O5S2/c25-13-4-5-14-18(11-13)34-24(26-14)27-20(17-2-1-9-33-17)19(22(29)23(27)30)21(28)12-3-6-15-16(10-12)32-8-7-31-15/h1-6,9-11,20,28H,7-8H2/t20-/m0/s1 |
| InChIKey | GOYOUIDHQDFOHK-FQEVSTJZSA-N |
| XLogP | 5.41 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|