C26H16Cl2N2O5S — CID 98381232
(4E,5R)-1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3-chlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione (PubChem CID 98381232) has the molecular formula C26H16Cl2N2O5S and a molecular weight of 539.40 g/mol. Its IUPAC name is (4E,5R)-1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3-chlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3-chlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98381232 |
| Molecular Formula | C26H16Cl2N2O5S |
| Molecular Weight | 539.40 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | (4E,5R)-1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3-chlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3ccc(Cl)cc3s2)[C@H](c2cccc(Cl)c2)/C1=C(\O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C26H16Cl2N2O5S/c27-15-3-1-2-13(10-15)22-21(23(31)14-4-7-18-19(11-14)35-9-8-34-18)24(32)25(33)30(22)26-29-17-6-5-16(28)12-20(17)36-26/h1-7,10-12,22,31H,8-9H2/b23-21+/t22-/m1/s1 |
| InChIKey | SJBLOZWZIUCVCX-HOGKFDNTSA-N |
| XLogP | 6.00 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.40 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|