C26H16ClFN2O5S — CID 6229690
(4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione (PubChem CID 6229690) has the molecular formula C26H16ClFN2O5S and a molecular weight of 522.94 g/mol. Its IUPAC name is (4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6229690 |
| Molecular Formula | C26H16ClFN2O5S |
| Molecular Weight | 522.94 g/mol |
| Exact Mass | 522.05 |
| IUPAC Name | (4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3ccc(Cl)cc3s2)C(c2ccccc2F)/C1=C(\O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C26H16ClFN2O5S/c27-14-6-7-17-20(12-14)36-26(29-17)30-22(15-3-1-2-4-16(15)28)21(24(32)25(30)33)23(31)13-5-8-18-19(11-13)35-10-9-34-18/h1-8,11-12,22,31H,9-10H2/b23-21+ |
| InChIKey | LQPONVLMFCMRNH-XTQSDGFTSA-N |
| XLogP | 5.49 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.94 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|