C25H19FN2O6S — CID 41078102
(5R)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione (PubChem CID 41078102) has the molecular formula C25H19FN2O6S and a molecular weight of 494.50 g/mol. Its IUPAC name is (5R)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41078102 |
| Molecular Formula | C25H19FN2O6S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | (5R)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione |
| SMILES | CC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccc4c(c3)OCCO4)[C@@H]2c2ccccc2F)nc1C |
| InChI | InChI=1S/C25H19FN2O6S/c1-12-23(13(2)29)35-25(27-12)28-20(15-5-3-4-6-16(15)26)19(22(31)24(28)32)21(30)14-7-8-17-18(11-14)34-10-9-33-17/h3-8,11,20,30H,9-10H2,1-2H3/t20-/m0/s1 |
| InChIKey | UTVJPYQIOHJWQX-FQEVSTJZSA-N |
| XLogP | 4.19 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|