C31H32N2O8S — CID 98331173
(4E,5S)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(4-butoxy-3-ethoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione (PubChem CID 98331173) has the molecular formula C31H32N2O8S and a molecular weight of 592.67 g/mol. Its IUPAC name is (4E,5S)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(4-butoxy-3-ethoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(4-butoxy-3-ethoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98331173 |
| Molecular Formula | C31H32N2O8S |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | (4E,5S)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(4-butoxy-3-ethoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCCCOc1ccc([C@H]2/C(=C(\O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2c2nc(C)c(C(C)=O)s2)cc1OCC |
| InChI | InChI=1S/C31H32N2O8S/c1-5-7-12-39-21-10-8-19(15-23(21)38-6-2)26-25(27(35)20-9-11-22-24(16-20)41-14-13-40-22)28(36)30(37)33(26)31-32-17(3)29(42-31)18(4)34/h8-11,15-16,26,35H,5-7,12-14H2,1-4H3/b27-25+/t26-/m0/s1 |
| InChIKey | GUXQUNIZHZYFBE-CZNAVJSXSA-N |
| XLogP | 5.63 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|