C26H22N2O7S — CID 41040157
(5R)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 41040157) has the molecular formula C26H22N2O7S and a molecular weight of 506.54 g/mol. Its IUPAC name is (5R)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41040157 |
| Molecular Formula | C26H22N2O7S |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | (5R)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc([C@@H]2C(=C(O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2c2nc(C)c(C(C)=O)s2)cc1 |
| InChI | InChI=1S/C26H22N2O7S/c1-13-24(14(2)29)36-26(27-13)28-21(15-4-7-17(33-3)8-5-15)20(23(31)25(28)32)22(30)16-6-9-18-19(12-16)35-11-10-34-18/h4-9,12,21,30H,10-11H2,1-3H3/t21-/m1/s1 |
| InChIKey | NOYAEPOMJGQDFT-OAQYLSRUSA-N |
| XLogP | 4.06 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|