C25H20N2O7S — CID 6133824
methyl 2-[(4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 6133824) has the molecular formula C25H20N2O7S and a molecular weight of 492.51 g/mol. Its IUPAC name is methyl 2-[(4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 6133824 |
| Molecular Formula | C25H20N2O7S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | methyl 2-[(4E)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3ccc4c(c3)OCCO4)C2c2ccccc2)nc1C |
| InChI | InChI=1S/C25H20N2O7S/c1-13-22(24(31)32-2)35-25(26-13)27-19(14-6-4-3-5-7-14)18(21(29)23(27)30)20(28)15-8-9-16-17(12-15)34-11-10-33-16/h3-9,12,19,28H,10-11H2,1-2H3/b20-18+ |
| InChIKey | XDGOHZHTMCVVHD-CZIZESTLSA-N |
| XLogP | 3.64 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|