C27H24N2O9S — CID 4508890
methyl 2-[3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2-(3,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4508890) has the molecular formula C27H24N2O9S and a molecular weight of 552.56 g/mol. Its IUPAC name is methyl 2-[3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2-(3,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2-(3,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4508890 |
| Molecular Formula | C27H24N2O9S |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | methyl 2-[3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2-(3,4-dimethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccc4c(c3)OCCO4)C2c2ccc(OC)c(OC)c2)nc1C |
| InChI | InChI=1S/C27H24N2O9S/c1-13-24(26(33)36-4)39-27(28-13)29-21(14-5-7-16(34-2)18(11-14)35-3)20(23(31)25(29)32)22(30)15-6-8-17-19(12-15)38-10-9-37-17/h5-8,11-12,21,30H,9-10H2,1-4H3 |
| InChIKey | FBSZLBNJTNPTFH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 133.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|