C26H24N2O8S — CID 98347206
methyl 2-[(2S,3E)-2-(3,4-dimethoxyphenyl)-3-[hydroxy-(3-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 98347206) has the molecular formula C26H24N2O8S and a molecular weight of 524.55 g/mol. Its IUPAC name is methyl 2-[(2S,3E)-2-(3,4-dimethoxyphenyl)-3-[hydroxy-(3-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(2S,3E)-2-(3,4-dimethoxyphenyl)-3-[hydroxy-(3-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 98347206 |
| Molecular Formula | C26H24N2O8S |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | methyl 2-[(2S,3E)-2-(3,4-dimethoxyphenyl)-3-[hydroxy-(3-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3cccc(OC)c3)[C@@H]2c2ccc(OC)c(OC)c2)nc1C |
| InChI | InChI=1S/C26H24N2O8S/c1-13-23(25(32)36-5)37-26(27-13)28-20(14-9-10-17(34-3)18(12-14)35-4)19(22(30)24(28)31)21(29)15-7-6-8-16(11-15)33-2/h6-12,20,29H,1-5H3/b21-19+/t20-/m0/s1 |
| InChIKey | RLZNMNJPGBTIBB-NHFXJNLRSA-N |
| XLogP | 3.89 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|