C30H28N2O8S — CID 4511383
prop-2-enyl 2-[4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2,3-dioxo-5-(4-propoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4511383) has the molecular formula C30H28N2O8S and a molecular weight of 576.63 g/mol. Its IUPAC name is prop-2-enyl 2-[4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2,3-dioxo-5-(4-propoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2,3-dioxo-5-(4-propoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4511383 |
| Molecular Formula | C30H28N2O8S |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | prop-2-enyl 2-[4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-2,3-dioxo-5-(4-propoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccc4c(c3)OCCO4)C2c2ccc(OCCC)cc2)nc1C |
| InChI | InChI=1S/C30H28N2O8S/c1-4-12-37-20-9-6-18(7-10-20)24-23(25(33)19-8-11-21-22(16-19)39-15-14-38-21)26(34)28(35)32(24)30-31-17(3)27(41-30)29(36)40-13-5-2/h5-11,16,24,33H,2,4,12-15H2,1,3H3 |
| InChIKey | CXLRUSALXSLBAM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|