C30H30N2O7S — CID 4070255
prop-2-enyl 2-[3-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4070255) has the molecular formula C30H30N2O7S and a molecular weight of 562.64 g/mol. Its IUPAC name is prop-2-enyl 2-[3-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[3-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4070255 |
| Molecular Formula | C30H30N2O7S |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | prop-2-enyl 2-[3-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccc(OCCC)c(C)c3)C2c2ccc(OC)cc2)nc1C |
| InChI | InChI=1S/C30H30N2O7S/c1-6-14-38-22-13-10-20(16-17(22)3)25(33)23-24(19-8-11-21(37-5)12-9-19)32(28(35)26(23)34)30-31-18(4)27(40-30)29(36)39-15-7-2/h7-13,16,24,33H,2,6,14-15H2,1,3-5H3 |
| InChIKey | NEUFEYWOILXWGE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|