C29H28N2O8S — CID 23875560
prop-2-enyl 2-[(3Z)-2-(3,4-dimethoxyphenyl)-3-[(4-ethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 23875560) has the molecular formula C29H28N2O8S and a molecular weight of 564.62 g/mol. Its IUPAC name is prop-2-enyl 2-[(3Z)-2-(3,4-dimethoxyphenyl)-3-[(4-ethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[(3Z)-2-(3,4-dimethoxyphenyl)-3-[(4-ethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 23875560 |
| Molecular Formula | C29H28N2O8S |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | prop-2-enyl 2-[(3Z)-2-(3,4-dimethoxyphenyl)-3-[(4-ethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)/C(=C(\O)c3ccc(OCC)cc3)C2c2ccc(OC)c(OC)c2)nc1C |
| InChI | InChI=1S/C29H28N2O8S/c1-6-14-39-28(35)26-16(3)30-29(40-26)31-23(18-10-13-20(36-4)21(15-18)37-5)22(25(33)27(31)34)24(32)17-8-11-19(12-9-17)38-7-2/h6,8-13,15,23,32H,1,7,14H2,2-5H3/b24-22- |
| InChIKey | HUMZBIFNAOSBLK-GYHWCHFESA-N |
| XLogP | 4.84 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|