C35H32N2O8S — CID 18812504
prop-2-enyl 2-[(3E)-2-(4-ethoxy-3-methoxyphenyl)-3-[hydroxy-(4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 18812504) has the molecular formula C35H32N2O8S and a molecular weight of 640.71 g/mol. Its IUPAC name is prop-2-enyl 2-[(3E)-2-(4-ethoxy-3-methoxyphenyl)-3-[hydroxy-(4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[(3E)-2-(4-ethoxy-3-methoxyphenyl)-3-[hydroxy-(4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 18812504 |
| Molecular Formula | C35H32N2O8S |
| Molecular Weight | 640.71 g/mol |
| Exact Mass | 640.19 |
| IUPAC Name | prop-2-enyl 2-[(3E)-2-(4-ethoxy-3-methoxyphenyl)-3-[hydroxy-(4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3ccc(OCc4ccccc4)cc3)C2c2ccc(OCC)c(OC)c2)nc1C |
| InChI | InChI=1S/C35H32N2O8S/c1-5-18-44-34(41)32-21(3)36-35(46-32)37-29(24-14-17-26(43-6-2)27(19-24)42-4)28(31(39)33(37)40)30(38)23-12-15-25(16-13-23)45-20-22-10-8-7-9-11-22/h5,7-17,19,29,38H,1,6,18,20H2,2-4H3/b30-28+ |
| InChIKey | YUSCVLCIADXCDW-SJCQXOIGSA-N |
| XLogP | 6.41 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.71 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|