C34H32N2O8S — CID 98338465
methyl 2-[(2S,3E)-2-(4-ethoxy-3-methoxyphenyl)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 98338465) has the molecular formula C34H32N2O8S and a molecular weight of 628.70 g/mol. Its IUPAC name is methyl 2-[(2S,3E)-2-(4-ethoxy-3-methoxyphenyl)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(2S,3E)-2-(4-ethoxy-3-methoxyphenyl)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 98338465 |
| Molecular Formula | C34H32N2O8S |
| Molecular Weight | 628.70 g/mol |
| Exact Mass | 628.19 |
| IUPAC Name | methyl 2-[(2S,3E)-2-(4-ethoxy-3-methoxyphenyl)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOc1ccc([C@H]2/C(=C(\O)c3ccc(OCc4ccccc4)c(C)c3)C(=O)C(=O)N2c2nc(C)c(C(=O)OC)s2)cc1OC |
| InChI | InChI=1S/C34H32N2O8S/c1-6-43-25-15-12-22(17-26(25)41-4)28-27(30(38)32(39)36(28)34-35-20(3)31(45-34)33(40)42-5)29(37)23-13-14-24(19(2)16-23)44-18-21-10-8-7-9-11-21/h7-17,28,37H,6,18H2,1-5H3/b29-27+/t28-/m0/s1 |
| InChIKey | DKDFIBVSLPAKMF-TXTDGAROSA-N |
| XLogP | 6.16 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.70 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|