C35H34N2O6S — CID 98382535
methyl 2-[(2S,3E)-2-(4-tert-butylphenyl)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 98382535) has the molecular formula C35H34N2O6S and a molecular weight of 610.73 g/mol. Its IUPAC name is methyl 2-[(2S,3E)-2-(4-tert-butylphenyl)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(2S,3E)-2-(4-tert-butylphenyl)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 98382535 |
| Molecular Formula | C35H34N2O6S |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | methyl 2-[(2S,3E)-2-(4-tert-butylphenyl)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3ccc(OCc4ccccc4)c(C)c3)[C@@H]2c2ccc(C(C)(C)C)cc2)nc1C |
| InChI | InChI=1S/C35H34N2O6S/c1-20-18-24(14-17-26(20)43-19-22-10-8-7-9-11-22)29(38)27-28(23-12-15-25(16-13-23)35(3,4)5)37(32(40)30(27)39)34-36-21(2)31(44-34)33(41)42-6/h7-18,28,38H,19H2,1-6H3/b29-27+/t28-/m0/s1 |
| InChIKey | BZQKCDGEJVZXGW-TXTDGAROSA-N |
| XLogP | 7.05 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|