C34H30N2O8S — CID 98188414
prop-2-enyl 2-[(2S,3E)-2-(4-hydroxy-3-methoxyphenyl)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 98188414) has the molecular formula C34H30N2O8S and a molecular weight of 626.69 g/mol. Its IUPAC name is prop-2-enyl 2-[(2S,3E)-2-(4-hydroxy-3-methoxyphenyl)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[(2S,3E)-2-(4-hydroxy-3-methoxyphenyl)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 98188414 |
| Molecular Formula | C34H30N2O8S |
| Molecular Weight | 626.69 g/mol |
| Exact Mass | 626.17 |
| IUPAC Name | prop-2-enyl 2-[(2S,3E)-2-(4-hydroxy-3-methoxyphenyl)-3-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3ccc(OCc4ccccc4)c(C)c3)[C@@H]2c2ccc(O)c(OC)c2)nc1C |
| InChI | InChI=1S/C34H30N2O8S/c1-5-15-43-33(41)31-20(3)35-34(45-31)36-28(22-11-13-24(37)26(17-22)42-4)27(30(39)32(36)40)29(38)23-12-14-25(19(2)16-23)44-18-21-9-7-6-8-10-21/h5-14,16-17,28,37-38H,1,15,18H2,2-4H3/b29-27+/t28-/m0/s1 |
| InChIKey | OUDMSEHDFGOIQX-TXTDGAROSA-N |
| XLogP | 6.02 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.69 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|