C41H36N2O8S — CID 4699327
prop-2-enyl 2-[3-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-(3-methoxy-4-phenylmethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4699327) has the molecular formula C41H36N2O8S and a molecular weight of 716.81 g/mol. Its IUPAC name is prop-2-enyl 2-[3-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-(3-methoxy-4-phenylmethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[3-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-(3-methoxy-4-phenylmethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4699327 |
| Molecular Formula | C41H36N2O8S |
| Molecular Weight | 716.81 g/mol |
| Exact Mass | 716.22 |
| IUPAC Name | prop-2-enyl 2-[3-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-(3-methoxy-4-phenylmethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccc(OCc4ccccc4C)cc3)C2c2ccc(OCc3ccccc3)c(OC)c2)nc1C |
| InChI | InChI=1S/C41H36N2O8S/c1-5-21-49-40(47)38-26(3)42-41(52-38)43-35(29-17-20-32(33(22-29)48-4)51-23-27-12-7-6-8-13-27)34(37(45)39(43)46)36(44)28-15-18-31(19-16-28)50-24-30-14-10-9-11-25(30)2/h5-20,22,35,44H,1,21,23-24H2,2-4H3 |
| InChIKey | GZDAUKUGRFBDPG-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.81 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|