C40H36N2O8S — CID 4699326
ethyl 2-[3-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-(3-methoxy-4-phenylmethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4699326) has the molecular formula C40H36N2O8S and a molecular weight of 704.80 g/mol. Its IUPAC name is ethyl 2-[3-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-(3-methoxy-4-phenylmethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[3-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-(3-methoxy-4-phenylmethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4699326 |
| Molecular Formula | C40H36N2O8S |
| Molecular Weight | 704.80 g/mol |
| Exact Mass | 704.22 |
| IUPAC Name | ethyl 2-[3-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-(3-methoxy-4-phenylmethoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccc(OCc4ccccc4C)cc3)C2c2ccc(OCc3ccccc3)c(OC)c2)nc1C |
| InChI | InChI=1S/C40H36N2O8S/c1-5-48-39(46)37-25(3)41-40(51-37)42-34(28-17-20-31(32(21-28)47-4)50-22-26-12-7-6-8-13-26)33(36(44)38(42)45)35(43)27-15-18-30(19-16-27)49-23-29-14-10-9-11-24(29)2/h6-21,34,43H,5,22-23H2,1-4H3 |
| InChIKey | OKKHBVRBYZWWTB-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.80 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|