C35H34N2O9S — CID 4314877
ethyl 2-[4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-(3,4,5-trimethoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4314877) has the molecular formula C35H34N2O9S and a molecular weight of 658.73 g/mol. Its IUPAC name is ethyl 2-[4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-(3,4,5-trimethoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-(3,4,5-trimethoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4314877 |
| Molecular Formula | C35H34N2O9S |
| Molecular Weight | 658.73 g/mol |
| Exact Mass | 658.20 |
| IUPAC Name | ethyl 2-[4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-(3,4,5-trimethoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccc(OCc4ccccc4)cc3C)C2c2cc(OC)c(OC)c(OC)c2)nc1C |
| InChI | InChI=1S/C35H34N2O9S/c1-7-45-34(41)32-20(3)36-35(47-32)37-28(22-16-25(42-4)31(44-6)26(17-22)43-5)27(30(39)33(37)40)29(38)24-14-13-23(15-19(24)2)46-18-21-11-9-8-10-12-21/h8-17,28,38H,7,18H2,1-6H3 |
| InChIKey | OJNPRQCGYRYILX-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 133.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|