C33H28N2O6S — CID 4698657
prop-2-enyl 2-[4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4698657) has the molecular formula C33H28N2O6S and a molecular weight of 580.66 g/mol. Its IUPAC name is prop-2-enyl 2-[4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4698657 |
| Molecular Formula | C33H28N2O6S |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | prop-2-enyl 2-[4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccc(OCc4ccccc4C)cc3)C2c2ccccc2)nc1C |
| InChI | InChI=1S/C33H28N2O6S/c1-4-18-40-32(39)30-21(3)34-33(42-30)35-27(22-11-6-5-7-12-22)26(29(37)31(35)38)28(36)23-14-16-25(17-15-23)41-19-24-13-9-8-10-20(24)2/h4-17,27,36H,1,18-19H2,2-3H3 |
| InChIKey | BCMVLQDVUAHWIJ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|