C28H27N3O6S — CID 18812548
prop-2-enyl 2-[(4E)-4-[(4-butoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 18812548) has the molecular formula C28H27N3O6S and a molecular weight of 533.61 g/mol. Its IUPAC name is prop-2-enyl 2-[(4E)-4-[(4-butoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[(4E)-4-[(4-butoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 18812548 |
| Molecular Formula | C28H27N3O6S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | prop-2-enyl 2-[(4E)-4-[(4-butoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-4-ylpyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3ccc(OCCCC)cc3)C2c2ccncc2)nc1C |
| InChI | InChI=1S/C28H27N3O6S/c1-4-6-16-36-20-9-7-19(8-10-20)23(32)21-22(18-11-13-29-14-12-18)31(26(34)24(21)33)28-30-17(3)25(38-28)27(35)37-15-5-2/h5,7-14,22,32H,2,4,6,15-16H2,1,3H3/b23-21+ |
| InChIKey | HEKUDCDCQFAMNU-XTQSDGFTSA-N |
| XLogP | 4.99 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|