C24H18ClN3O5S — CID 4736577
prop-2-enyl 2-[2-(4-chlorophenyl)-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4736577) has the molecular formula C24H18ClN3O5S and a molecular weight of 495.94 g/mol. Its IUPAC name is prop-2-enyl 2-[2-(4-chlorophenyl)-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[2-(4-chlorophenyl)-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4736577 |
| Molecular Formula | C24H18ClN3O5S |
| Molecular Weight | 495.94 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | prop-2-enyl 2-[2-(4-chlorophenyl)-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccncc3)C2c2ccc(Cl)cc2)nc1C |
| InChI | InChI=1S/C24H18ClN3O5S/c1-3-12-33-23(32)21-13(2)27-24(34-21)28-18(14-4-6-16(25)7-5-14)17(20(30)22(28)31)19(29)15-8-10-26-11-9-15/h3-11,18,29H,1,12H2,2H3 |
| InChIKey | AEEHJBAKGSHGNG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.94 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|