C31H25N3O6S — CID 3264139
prop-2-enyl 2-[4-[hydroxy(pyridin-4-yl)methylidene]-2,3-dioxo-5-(3-phenylmethoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 3264139) has the molecular formula C31H25N3O6S and a molecular weight of 567.62 g/mol. Its IUPAC name is prop-2-enyl 2-[4-[hydroxy(pyridin-4-yl)methylidene]-2,3-dioxo-5-(3-phenylmethoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[4-[hydroxy(pyridin-4-yl)methylidene]-2,3-dioxo-5-(3-phenylmethoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 3264139 |
| Molecular Formula | C31H25N3O6S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | prop-2-enyl 2-[4-[hydroxy(pyridin-4-yl)methylidene]-2,3-dioxo-5-(3-phenylmethoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccncc3)C2c2cccc(OCc3ccccc3)c2)nc1C |
| InChI | InChI=1S/C31H25N3O6S/c1-3-16-39-30(38)28-19(2)33-31(41-28)34-25(24(27(36)29(34)37)26(35)21-12-14-32-15-13-21)22-10-7-11-23(17-22)40-18-20-8-5-4-6-9-20/h3-15,17,25,35H,1,16,18H2,2H3 |
| InChIKey | CIBXRJOTMDLEIG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|