C35H32N2O7S — CID 98128664
prop-2-enyl 2-[(5S)-4-[(4-butoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-(3-phenoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 98128664) has the molecular formula C35H32N2O7S and a molecular weight of 624.72 g/mol. Its IUPAC name is prop-2-enyl 2-[(5S)-4-[(4-butoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-(3-phenoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[(5S)-4-[(4-butoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-(3-phenoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 98128664 |
| Molecular Formula | C35H32N2O7S |
| Molecular Weight | 624.72 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | prop-2-enyl 2-[(5S)-4-[(4-butoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-(3-phenoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccc(OCCCC)cc3)[C@@H]2c2cccc(Oc3ccccc3)c2)nc1C |
| InChI | InChI=1S/C35H32N2O7S/c1-4-6-20-42-25-17-15-23(16-18-25)30(38)28-29(24-11-10-14-27(21-24)44-26-12-8-7-9-13-26)37(33(40)31(28)39)35-36-22(3)32(45-35)34(41)43-19-5-2/h5,7-18,21,29,38H,2,4,6,19-20H2,1,3H3/t29-/m0/s1 |
| InChIKey | IAKGBFFEQISEAD-LJAQVGFWSA-N |
| XLogP | 7.39 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.72 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|