C29H27BrN2O6S — CID 3289109
prop-2-enyl 2-[2-(3-bromophenyl)-3-[(3-butoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 3289109) has the molecular formula C29H27BrN2O6S and a molecular weight of 611.51 g/mol. Its IUPAC name is prop-2-enyl 2-[2-(3-bromophenyl)-3-[(3-butoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[2-(3-bromophenyl)-3-[(3-butoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 3289109 |
| Molecular Formula | C29H27BrN2O6S |
| Molecular Weight | 611.51 g/mol |
| Exact Mass | 610.08 |
| IUPAC Name | prop-2-enyl 2-[2-(3-bromophenyl)-3-[(3-butoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3cccc(OCCCC)c3)C2c2cccc(Br)c2)nc1C |
| InChI | InChI=1S/C29H27BrN2O6S/c1-4-6-14-37-21-12-8-10-19(16-21)24(33)22-23(18-9-7-11-20(30)15-18)32(27(35)25(22)34)29-31-17(3)26(39-29)28(36)38-13-5-2/h5,7-12,15-16,23,33H,2,4,6,13-14H2,1,3H3 |
| InChIKey | QCKVWHAGDDPPMJ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.51 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|