C29H27BrN2O8S — CID 3286783
prop-2-enyl 2-[2-(3-bromo-4-hydroxy-5-methoxyphenyl)-3-[hydroxy-(3-propoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 3286783) has the molecular formula C29H27BrN2O8S and a molecular weight of 643.51 g/mol. Its IUPAC name is prop-2-enyl 2-[2-(3-bromo-4-hydroxy-5-methoxyphenyl)-3-[hydroxy-(3-propoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[2-(3-bromo-4-hydroxy-5-methoxyphenyl)-3-[hydroxy-(3-propoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 3286783 |
| Molecular Formula | C29H27BrN2O8S |
| Molecular Weight | 643.51 g/mol |
| Exact Mass | 642.07 |
| IUPAC Name | prop-2-enyl 2-[2-(3-bromo-4-hydroxy-5-methoxyphenyl)-3-[hydroxy-(3-propoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3cccc(OCCC)c3)C2c2cc(Br)c(O)c(OC)c2)nc1C |
| InChI | InChI=1S/C29H27BrN2O8S/c1-5-10-39-18-9-7-8-16(12-18)23(33)21-22(17-13-19(30)24(34)20(14-17)38-4)32(27(36)25(21)35)29-31-15(3)26(41-29)28(37)40-11-6-2/h6-9,12-14,22,33-34H,2,5,10-11H2,1,3-4H3 |
| InChIKey | BFLXNIHPYNEYRU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|