C32H32N2O7S — CID 45128558
prop-2-enyl 2-[(3Z)-2-(3-butoxyphenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 45128558) has the molecular formula C32H32N2O7S and a molecular weight of 588.68 g/mol. Its IUPAC name is prop-2-enyl 2-[(3Z)-2-(3-butoxyphenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[(3Z)-2-(3-butoxyphenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 45128558 |
| Molecular Formula | C32H32N2O7S |
| Molecular Weight | 588.68 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | prop-2-enyl 2-[(3Z)-2-(3-butoxyphenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)/C(=C(\O)c3ccc4c(c3)CC(C)O4)C2c2cccc(OCCCC)c2)nc1C |
| InChI | InChI=1S/C32H32N2O7S/c1-5-7-14-39-23-10-8-9-20(17-23)26-25(27(35)21-11-12-24-22(16-21)15-18(3)41-24)28(36)30(37)34(26)32-33-19(4)29(42-32)31(38)40-13-6-2/h6,8-12,16-18,26,35H,2,5,7,13-15H2,1,3-4H3/b27-25- |
| InChIKey | AKTJLYXQLCEYGW-RFBIWTDZSA-N |
| XLogP | 5.92 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.68 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|