C28H22Cl2N2O6S — CID 6135058
prop-2-enyl 2-[(3E)-2-(2,4-dichlorophenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 6135058) has the molecular formula C28H22Cl2N2O6S and a molecular weight of 585.47 g/mol. Its IUPAC name is prop-2-enyl 2-[(3E)-2-(2,4-dichlorophenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[(3E)-2-(2,4-dichlorophenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 6135058 |
| Molecular Formula | C28H22Cl2N2O6S |
| Molecular Weight | 585.47 g/mol |
| Exact Mass | 584.06 |
| IUPAC Name | prop-2-enyl 2-[(3E)-2-(2,4-dichlorophenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3ccc4c(c3)CC(C)O4)C2c2ccc(Cl)cc2Cl)nc1C |
| InChI | InChI=1S/C28H22Cl2N2O6S/c1-4-9-37-27(36)25-14(3)31-28(39-25)32-22(18-7-6-17(29)12-19(18)30)21(24(34)26(32)35)23(33)15-5-8-20-16(11-15)10-13(2)38-20/h4-8,11-13,22,33H,1,9-10H2,2-3H3/b23-21+ |
| InChIKey | CYBHEMURKYARHZ-XTQSDGFTSA-N |
| XLogP | 6.05 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.47 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|