C29H31N3O6S — CID 5261447
ethyl 2-[2-(4-hexoxyphenyl)-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 5261447) has the molecular formula C29H31N3O6S and a molecular weight of 549.65 g/mol. Its IUPAC name is ethyl 2-[2-(4-hexoxyphenyl)-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[2-(4-hexoxyphenyl)-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 5261447 |
| Molecular Formula | C29H31N3O6S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | ethyl 2-[2-(4-hexoxyphenyl)-3-[hydroxy(pyridin-4-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCCOc1ccc(C2C(=C(O)c3ccncc3)C(=O)C(=O)N2c2nc(C)c(C(=O)OCC)s2)cc1 |
| InChI | InChI=1S/C29H31N3O6S/c1-4-6-7-8-17-38-21-11-9-19(10-12-21)23-22(24(33)20-13-15-30-16-14-20)25(34)27(35)32(23)29-31-18(3)26(39-29)28(36)37-5-2/h9-16,23,33H,4-8,17H2,1-3H3 |
| InChIKey | UDGSEYDMXPFJSO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|